C32H48N2O2 — CID 171722406
N-[4-(adamantane-1-carbonylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]adamantane-1-carboxamide (PubChem CID 171722406) has the molecular formula C32H48N2O2 and a molecular weight of 492.75 g/mol. Its IUPAC name is N-[4-(adamantane-1-carbonylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]adamantane-1-carboxamide.
| Compound Name | N-[4-(adamantane-1-carbonylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171722406 |
| Molecular Formula | C32H48N2O2 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.37 |
| IUPAC Name | N-[4-(adamantane-1-carbonylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]adamantane-1-carboxamide |
| SMILES | O=C(NC1CCC(NC(=O)C23CC4CC(CC(C4)C2)C3)C2CCCCC12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H48N2O2/c35-29(31-13-19-7-20(14-31)9-21(8-19)15-31)33-27-5-6-28(26-4-2-1-3-25(26)27)34-30(36)32-16-22-10-23(17-32)12-24(11-22)18-32/h19-28H,1-18H2,(H,33,35)(H,34,36) |
| InChIKey | ZQNFGZKMROBMSS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |