C18H32N4O2 — CID 171722600
N-[3-(piperidine-4-carbonylamino)cyclohexyl]piperidine-4-carboxamide (PubChem CID 171722600) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[3-(piperidine-4-carbonylamino)cyclohexyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(piperidine-4-carbonylamino)cyclohexyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 171722600 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | N-[3-(piperidine-4-carbonylamino)cyclohexyl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CCCC(NC(=O)C2CCNCC2)C1)C1CCNCC1 |
| InChI | InChI=1S/C18H32N4O2/c23-17(13-4-8-19-9-5-13)21-15-2-1-3-16(12-15)22-18(24)14-6-10-20-11-7-14/h13-16,19-20H,1-12H2,(H,21,23)(H,22,24) |
| InChIKey | SIOQMTDVTWBTSO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |