C36H45N3O3 — CID 171722603
1-adamantyl-[4,6-bis(adamantane-1-carbonyl)-1,3,5-triazin-2-yl]methanone (PubChem CID 171722603) has the molecular formula C36H45N3O3 and a molecular weight of 567.77 g/mol. Its IUPAC name is 1-adamantyl-[4,6-bis(adamantane-1-carbonyl)-1,3,5-triazin-2-yl]methanone.
| Compound Name | 1-adamantyl-[4,6-bis(adamantane-1-carbonyl)-1,3,5-triazin-2-yl]methanone |
|---|---|
| PubChem CID | 171722603 |
| Molecular Formula | C36H45N3O3 |
| Molecular Weight | 567.77 g/mol |
| Exact Mass | 567.35 |
| IUPAC Name | 1-adamantyl-[4,6-bis(adamantane-1-carbonyl)-1,3,5-triazin-2-yl]methanone |
| SMILES | O=C(c1nc(C(=O)C23CC4CC(CC(C4)C2)C3)nc(C(=O)C23CC4CC(CC(C4)C2)C3)n1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C36H45N3O3/c40-28(34-10-19-1-20(11-34)3-21(2-19)12-34)31-37-32(29(41)35-13-22-4-23(14-35)6-24(5-22)15-35)39-33(38-31)30(42)36-16-25-7-26(17-36)9-27(8-25)18-36/h19-27H,1-18H2 |
| InChIKey | HGRLTYQNWCQRKR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 89.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |