C52H79N5 — CID 171722685
2-N,4-N,6-N-tris(1-adamantyl)-2-N,4-N,6-N-tricyclohexylpyrimidine-2,4,6-triamine (PubChem CID 171722685) has the molecular formula C52H79N5 and a molecular weight of 774.24 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(1-adamantyl)-2-N,4-N,6-N-tricyclohexylpyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(1-adamantyl)-2-N,4-N,6-N-tricyclohexylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 171722685 |
| Molecular Formula | C52H79N5 |
| Molecular Weight | 774.24 g/mol |
| Exact Mass | 773.63 |
| IUPAC Name | 2-N,4-N,6-N-tris(1-adamantyl)-2-N,4-N,6-N-tricyclohexylpyrimidine-2,4,6-triamine |
| SMILES | c1c(N(C2CCCCC2)C23CC4CC(CC(C4)C2)C3)nc(N(C2CCCCC2)C23CC4CC(CC(C4)C2)C3)nc1N(C1CCCCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C52H79N5/c1-4-10-44(11-5-1)55(50-26-35-16-36(27-50)18-37(17-35)28-50)47-25-48(56(45-12-6-2-7-13-45)51-29-38-19-39(30-51)21-40(20-38)31-51)54-49(53-47)57(46-14-8-3-9-15-46)52-32-41-22-42(33-52)24-43(23-41)34-52/h25,35-46H,1-24,26-34H2 |
| InChIKey | XSRGYJNOGNWLKM-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.24 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |