C48H69N3O3 — CID 171722690
1-N,3-N,5-N-tris(3,5,7-trimethyl-1-adamantyl)benzene-1,3,5-tricarboxamide (PubChem CID 171722690) has the molecular formula C48H69N3O3 and a molecular weight of 736.10 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(3,5,7-trimethyl-1-adamantyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(3,5,7-trimethyl-1-adamantyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 171722690 |
| Molecular Formula | C48H69N3O3 |
| Molecular Weight | 736.10 g/mol |
| Exact Mass | 735.53 |
| IUPAC Name | 1-N,3-N,5-N-tris(3,5,7-trimethyl-1-adamantyl)benzene-1,3,5-tricarboxamide |
| SMILES | CC12CC3(C)CC(C)(C1)CC(NC(=O)c1cc(C(=O)NC45CC6(C)CC(C)(CC(C)(C6)C4)C5)cc(C(=O)NC45CC6(C)CC(C)(CC(C)(C6)C4)C5)c1)(C2)C3 |
| InChI | InChI=1S/C48H69N3O3/c1-37-13-38(2)15-39(3,14-37)24-46(22-37,23-38)49-34(52)31-10-32(35(53)50-47-25-40(4)16-41(5,26-47)18-42(6,17-40)27-47)12-33(11-31)36(54)51-48-28-43(7)19-44(8,29-48)21-45(9,20-43)30-48/h10-12H,13-30H2,1-9H3,(H,49,52)(H,50,53)(H,51,54) |
| InChIKey | CPYOJHAIXXUJJJ-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.10 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |