C20H37FN2O — CID 171723132
(3R)-3-fluoro-4-propan-2-yl-1-[3-(1-propan-2-ylpiperidin-4-yl)oxycyclobutyl]piperidine (PubChem CID 171723132) has the molecular formula C20H37FN2O and a molecular weight of 340.53 g/mol. Its IUPAC name is (3R)-3-fluoro-4-propan-2-yl-1-[3-(1-propan-2-ylpiperidin-4-yl)oxycyclobutyl]piperidine.
| Compound Name | (3R)-3-fluoro-4-propan-2-yl-1-[3-(1-propan-2-ylpiperidin-4-yl)oxycyclobutyl]piperidine |
|---|---|
| PubChem CID | 171723132 |
| Molecular Formula | C20H37FN2O |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | (3R)-3-fluoro-4-propan-2-yl-1-[3-(1-propan-2-ylpiperidin-4-yl)oxycyclobutyl]piperidine |
| SMILES | CC(C)C1CCN(C2CC(OC3CCN(C(C)C)CC3)C2)C[C@@H]1F |
| InChI | InChI=1S/C20H37FN2O/c1-14(2)19-7-10-23(13-20(19)21)16-11-18(12-16)24-17-5-8-22(9-6-17)15(3)4/h14-20H,5-13H2,1-4H3/t16?,18?,19?,20-/m0/s1 |
| InChIKey | XNFWBVBZYBRGOS-GXVYMARFSA-N |
| XLogP | 3.72 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |