C9F18NNaO3S — CID 171725718
sodium 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)azanide (PubChem CID 171725718) has the molecular formula C9F18NNaO3S and a molecular weight of 567.12 g/mol. Its IUPAC name is sodium 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)azanide.
| Compound Name | sodium 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)azanide |
|---|---|
| PubChem CID | 171725718 |
| Molecular Formula | C9F18NNaO3S |
| Molecular Weight | 567.12 g/mol |
| Exact Mass | 566.92 |
| IUPAC Name | sodium 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)azanide |
| SMILES | O=C([N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C9HF18NO3S.Na/c10-2(11,3(12,13)4(14,15)7(20,21)22)1(29)28-32(30,31)9(26,27)6(18,19)5(16,17)8(23,24)25;/h(H,28,29);/q;+1/p-1 |
| InChIKey | IRXXIBXVJMXWST-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.12 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|