C20H37NO — CID 171725760
3,3-dicyclohexyl-N-(3-methylbutyl)propanamide (PubChem CID 171725760) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is 3,3-dicyclohexyl-N-(3-methylbutyl)propanamide.
| Compound Name | 3,3-dicyclohexyl-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 171725760 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | 3,3-dicyclohexyl-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)CC(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H37NO/c1-16(2)13-14-21-20(22)15-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h16-19H,3-15H2,1-2H3,(H,21,22) |
| InChIKey | XHSAZWUMQXREOR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |