C14H18N3NaO4 — CID 171726172
sodium 5-[(2R)-2-ethyl-4-methylpiperazin-1-yl]-2-nitrobenzoate (PubChem CID 171726172) has the molecular formula C14H18N3NaO4 and a molecular weight of 315.31 g/mol. Its IUPAC name is sodium 5-[(2R)-2-ethyl-4-methylpiperazin-1-yl]-2-nitrobenzoate.
| Compound Name | sodium 5-[(2R)-2-ethyl-4-methylpiperazin-1-yl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 171726172 |
| Molecular Formula | C14H18N3NaO4 |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | sodium 5-[(2R)-2-ethyl-4-methylpiperazin-1-yl]-2-nitrobenzoate |
| SMILES | CC[C@@H]1CN(C)CCN1c1ccc([N+](=O)[O-])c(C(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C14H19N3O4.Na/c1-3-10-9-15(2)6-7-16(10)11-4-5-13(17(20)21)12(8-11)14(18)19;/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,18,19);/q;+1/p-1/t10-;/m1./s1 |
| InChIKey | LYMVDZODZNIKAW-HNCPQSOCSA-M |
| XLogP | -2.51 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|