C14H14FNO2 — CID 17172904
N-[2-(4-fluorophenyl)ethyl]-5-methylfuran-2-carboxamide (PubChem CID 17172904) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 17172904 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C14H14FNO2/c1-10-2-7-13(18-10)14(17)16-9-8-11-3-5-12(15)6-4-11/h2-7H,8-9H2,1H3,(H,16,17) |
| InChIKey | SULYDIQXKZVZRA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |