C44H50N4O2 — CID 171729360
(4E)-3-oxo-2-(1',3,3',5-tetramethylspiro[cyclohexane-1,2'-perimidine]-6'-yl)-4-(1',3,3',5-tetramethylspiro[cyclohexane-1,2'-perimidin-3-ium]-6'-ylidene)cyclobuten-1-olate (PubChem CID 171729360) has the molecular formula C44H50N4O2 and a molecular weight of 666.91 g/mol. Its IUPAC name is (4E)-3-oxo-2-(1',3,3',5-tetramethylspiro[cyclohexane-1,2'-perimidine]-6'-yl)-4-(1',3,3',5-tetramethylspiro[cyclohexane-1,2'-perimidin-3-ium]-6'-ylidene)cyclobuten-1-olate.
| Compound Name | (4E)-3-oxo-2-(1',3,3',5-tetramethylspiro[cyclohexane-1,2'-perimidine]-6'-yl)-4-(1',3,3',5-tetramethylspiro[cyclohexane-1,2'-perimidin-3-ium]-6'-ylidene)cyclobuten-1-olate |
|---|---|
| PubChem CID | 171729360 |
| Molecular Formula | C44H50N4O2 |
| Molecular Weight | 666.91 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | (4E)-3-oxo-2-(1',3,3',5-tetramethylspiro[cyclohexane-1,2'-perimidine]-6'-yl)-4-(1',3,3',5-tetramethylspiro[cyclohexane-1,2'-perimidin-3-ium]-6'-ylidene)cyclobuten-1-olate |
| SMILES | CC1CC(C)CC2(C1)N(C)c1cccc3c(C4=C([O-])/C(=c5/ccc6c7c(cccc57)N(C)C5(CC(C)CC(C)C5)[N+]=6C)C4=O)ccc(c13)N2C |
| InChI | InChI=1S/C44H50N4O2/c1-25-19-26(2)22-43(21-25)45(5)33-13-9-11-29-31(15-17-35(37(29)33)47(43)7)39-41(49)40(42(39)50)32-16-18-36-38-30(32)12-10-14-34(38)46(6)44(48(36)8)23-27(3)20-28(4)24-44/h9-18,25-28H,19-24H2,1-8H3 |
| InChIKey | ACKRQMSVJSWXLT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.91 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|