C40H42N4O2 — CID 171729385
(4E)-2-(3',5'-dimethylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]-6-yl)-4-(3',5'-dimethylspiro[1H-perimidine-2,1'-cyclohexane]-6-ylidene)-3-hydroxycyclobut-2-en-1-one (PubChem CID 171729385) has the molecular formula C40H42N4O2 and a molecular weight of 610.80 g/mol. Its IUPAC name is (4E)-2-(3',5'-dimethylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]-6-yl)-4-(3',5'-dimethylspiro[1H-perimidine-2,1'-cyclohexane]-6-ylidene)-3-hydroxycyclobut-2-en-1-one.
| Compound Name | (4E)-2-(3',5'-dimethylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]-6-yl)-4-(3',5'-dimethylspiro[1H-perimidine-2,1'-cyclohexane]-6-ylidene)-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 171729385 |
| Molecular Formula | C40H42N4O2 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | (4E)-2-(3',5'-dimethylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]-6-yl)-4-(3',5'-dimethylspiro[1H-perimidine-2,1'-cyclohexane]-6-ylidene)-3-hydroxycyclobut-2-en-1-one |
| SMILES | CC1CC(C)CC2(C1)N=c1cc/c(=C3\C(=O)C(c4ccc5c6c(cccc46)NC4(CC(C)CC(C)C4)N5)=C3O)c3cccc(c13)N2 |
| InChI | InChI=1S/C40H42N4O2/c1-21-15-22(2)18-39(17-21)41-29-9-5-7-25-27(11-13-31(43-39)33(25)29)35-37(45)36(38(35)46)28-12-14-32-34-26(28)8-6-10-30(34)42-40(44-32)19-23(3)16-24(4)20-40/h5-14,21-24,41-43,45H,15-20H2,1-4H3/b36-28+ |
| InChIKey | CAYWSNJLXXLZKX-FDEZRRJOSA-N |
| XLogP | 7.88 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|