C61H59N3O7S — CID 171729799
3-[2,7-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-9-yl]-1-cyclohexylpropane-1-sulfonic acid (PubChem CID 171729799) has the molecular formula C61H59N3O7S and a molecular weight of 978.22 g/mol. Its IUPAC name is 3-[2,7-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-9-yl]-1-cyclohexylpropane-1-sulfonic acid.
| Compound Name | 3-[2,7-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-9-yl]-1-cyclohexylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 171729799 |
| Molecular Formula | C61H59N3O7S |
| Molecular Weight | 978.22 g/mol |
| Exact Mass | 977.41 |
| IUPAC Name | 3-[2,7-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-9-yl]-1-cyclohexylpropane-1-sulfonic acid |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3ccc4c5ccc(-c6ccc(N(c7ccc(OC)cc7)c7ccc(OC)cc7)cc6)cc5n(CCC(C5CCCCC5)S(=O)(=O)O)c4c3)cc2)cc1 |
| InChI | InChI=1S/C61H59N3O7S/c1-68-53-28-20-49(21-29-53)63(50-22-30-54(69-2)31-23-50)47-16-10-42(11-17-47)45-14-36-57-58-37-15-46(41-60(58)62(59(57)40-45)39-38-61(72(65,66)67)44-8-6-5-7-9-44)43-12-18-48(19-13-43)64(51-24-32-55(70-3)33-25-51)52-26-34-56(71-4)35-27-52/h10-37,40-41,44,61H,5-9,38-39H2,1-4H3,(H,65,66,67) |
| InChIKey | KOKCPVJPRNFCCE-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.22 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|