C17H24O2 — CID 171730184
1,1-bis[(E)-but-2-enoxy]propan-2-ylbenzene (PubChem CID 171730184) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1,1-bis[(E)-but-2-enoxy]propan-2-ylbenzene.
| Compound Name | 1,1-bis[(E)-but-2-enoxy]propan-2-ylbenzene |
|---|---|
| PubChem CID | 171730184 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 1,1-bis[(E)-but-2-enoxy]propan-2-ylbenzene |
| SMILES | C/C=C/COC(OC/C=C/C)C(C)c1ccccc1 |
| InChI | InChI=1S/C17H24O2/c1-4-6-13-18-17(19-14-7-5-2)15(3)16-11-9-8-10-12-16/h4-12,15,17H,13-14H2,1-3H3/b6-4+,7-5+ |
| InChIKey | YNAZFEQWMBPZEN-YDFGWWAZSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|