C35H27FIrN3O- — CID 171730701
1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;iridium;2-[1-(trideuteriomethyl)benzimidazol-2-yl]phenol (PubChem CID 171730701) has the molecular formula C35H27FIrN3O- and a molecular weight of 719.85 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;iridium;2-[1-(trideuteriomethyl)benzimidazol-2-yl]phenol.
| Compound Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;iridium;2-[1-(trideuteriomethyl)benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 171730701 |
| Molecular Formula | C35H27FIrN3O- |
| Molecular Weight | 719.85 g/mol |
| Exact Mass | 720.20 |
| IUPAC Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;iridium;2-[1-(trideuteriomethyl)benzimidazol-2-yl]phenol |
| SMILES | Cc1[c-]c(-c2nccc3cc(F)c4ccccc4c23)cc(C)c1.[2H]C([2H])([2H])n1c(-c2ccccc2O)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C21H15FN.C14H12N2O.Ir/c1-13-9-14(2)11-16(10-13)21-20-15(7-8-23-21)12-19(22)17-5-3-4-6-18(17)20;1-16-12-8-4-3-7-11(12)15-14(16)10-6-2-5-9-13(10)17;/h3-10,12H,1-2H3;2-9,17H,1H3;/q-1;;/i;1D3; |
| InChIKey | NJFDVSNOBHELLX-ICMJTWPQSA-N |
| XLogP | 8.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.85 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|