C16H12FNOS — CID 17173127
N-[(4-fluorophenyl)methyl]-1-benzothiophene-3-carboxamide (PubChem CID 17173127) has the molecular formula C16H12FNOS and a molecular weight of 285.34 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17173127 |
| Molecular Formula | C16H12FNOS |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1csc2ccccc12 |
| InChI | InChI=1S/C16H12FNOS/c17-12-7-5-11(6-8-12)9-18-16(19)14-10-20-15-4-2-1-3-13(14)15/h1-8,10H,9H2,(H,18,19) |
| InChIKey | RMXZALINRLNHST-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |