C30H34F3N5O5 — CID 171732836
CID 171732836 (PubChem CID 171732836) has the molecular formula C30H34F3N5O5 and a molecular weight of 601.63 g/mol.
| Compound Name | CID 171732836 |
|---|---|
| PubChem CID | 171732836 |
| Molecular Formula | C30H34F3N5O5 |
| Molecular Weight | 601.63 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | — |
| SMILES | CN(C(=O)[C@H](CC1CC1)NC(=O)C(F)(F)F)[C@@H](CC1CC1)C(=O)N1C[C@@]2(C[C@H]1C#N)Oc1ccccc1C1(CC1)NC2=O |
| InChI | InChI=1S/C30H34F3N5O5/c1-37(24(39)21(12-17-6-7-17)35-27(42)30(31,32)33)22(13-18-8-9-18)25(40)38-16-29(14-19(38)15-34)26(41)36-28(10-11-28)20-4-2-3-5-23(20)43-29/h2-5,17-19,21-22H,6-14,16H2,1H3,(H,35,42)(H,36,41)/t19-,21-,22-,29+/m0/s1 |
| InChIKey | YMNPAMARKUSVFZ-NZIJPQOOSA-N |
| XLogP | 2.52 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.63 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |