C28H23F4N5O4 — CID 171732908
N-[(2S)-1-[(2R,2'S)-2'-cyano-5-fluoro-3-oxospiro[4H-1,4-benzoxazine-2,4'-pyrrolidine]-1'-yl]-3-cyclopropyl-1-oxopropan-2-yl]-4,6,7-trifluoro-N-methyl-1H-indole-2-carboxamide (PubChem CID 171732908) has the molecular formula C28H23F4N5O4 and a molecular weight of 569.52 g/mol. Its IUPAC name is N-[(2S)-1-[(2R,2'S)-2'-cyano-5-fluoro-3-oxospiro[4H-1,4-benzoxazine-2,4'-pyrrolidine]-1'-yl]-3-cyclopropyl-1-oxopropan-2-yl]-4,6,7-trifluoro-N-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[(2R,2'S)-2'-cyano-5-fluoro-3-oxospiro[4H-1,4-benzoxazine-2,4'-pyrrolidine]-1'-yl]-3-cyclopropyl-1-oxopropan-2-yl]-4,6,7-trifluoro-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 171732908 |
| Molecular Formula | C28H23F4N5O4 |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | N-[(2S)-1-[(2R,2'S)-2'-cyano-5-fluoro-3-oxospiro[4H-1,4-benzoxazine-2,4'-pyrrolidine]-1'-yl]-3-cyclopropyl-1-oxopropan-2-yl]-4,6,7-trifluoro-N-methyl-1H-indole-2-carboxamide |
| SMILES | CN(C(=O)c1cc2c(F)cc(F)c(F)c2[nH]1)[C@@H](CC1CC1)C(=O)N1C[C@@]2(C[C@H]1C#N)Oc1cccc(F)c1NC2=O |
| InChI | InChI=1S/C28H23F4N5O4/c1-36(25(38)19-8-15-17(30)9-18(31)22(32)23(15)34-19)20(7-13-5-6-13)26(39)37-12-28(10-14(37)11-33)27(40)35-24-16(29)3-2-4-21(24)41-28/h2-4,8-9,13-14,20,34H,5-7,10,12H2,1H3,(H,35,40)/t14-,20-,28+/m0/s1 |
| InChIKey | RNRLGWKOHQAGBI-PMGMRBTKSA-N |
| XLogP | 3.86 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|