About 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate
1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate (PubChem CID 171733116) has the molecular formula C15H25NO7
and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate |
| PubChem CID | 171733116 |
| Molecular Formula | C15H25NO7 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate |
| SMILES | CCOC(=O)C1(CO)C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H25NO7/c1-6-22-12(19)15(9-17)7-10(11(18)21-5)16(8-15)13(20)23-14(2,3)4/h10,17H,6-9H2,1-5H3/t10-,15?/m0/s1 |
| InChIKey | BZIZDNRWRWIVQF-MYHCZTBNSA-N |
| XLogP | 0.71 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate?
The IUPAC name of 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate (CID 171733116) is 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate.
What is the SMILES notation for 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate?
The canonical SMILES for 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate is CCOC(=O)C1(CO)C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1.
What is the InChIKey of 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate?
The InChIKey is BZIZDNRWRWIVQF-MYHCZTBNSA-N. The full InChI is InChI=1S/C15H25NO7/c1-6-22-12(19)15(9-17)7-10(11(18)21-5)16(8-15)13(20)23-14(2,3)4/h10,17H,6-9H2,1-5H3/t10-,15?/m0/s1.
What are the key properties of 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate?
1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate has a molecular weight of 331.37 g/mol, XLogP of 0.71, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 4-O-ethyl 2-O-methyl (2S)-4-(hydroxymethyl)pyrrolidine-1,2,4-tricarboxylate is sourced from PubChem (CID 171733116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).