C23H31N5O6 — CID 171733516
tert-butyl N-[(2S)-1-[(2R,2'S)-2'-carbamoyl-3-oxospiro[4H-pyrido[3,2-b][1,4]oxazine-2,4'-pyrrolidine]-1'-yl]-3-cyclopropyl-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 171733516) has the molecular formula C23H31N5O6 and a molecular weight of 473.53 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2R,2'S)-2'-carbamoyl-3-oxospiro[4H-pyrido[3,2-b][1,4]oxazine-2,4'-pyrrolidine]-1'-yl]-3-cyclopropyl-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2R,2'S)-2'-carbamoyl-3-oxospiro[4H-pyrido[3,2-b][1,4]oxazine-2,4'-pyrrolidine]-1'-yl]-3-cyclopropyl-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171733516 |
| Molecular Formula | C23H31N5O6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2R,2'S)-2'-carbamoyl-3-oxospiro[4H-pyrido[3,2-b][1,4]oxazine-2,4'-pyrrolidine]-1'-yl]-3-cyclopropyl-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H](CC1CC1)C(=O)N1C[C@@]2(C[C@H]1C(N)=O)Oc1cccnc1NC2=O |
| InChI | InChI=1S/C23H31N5O6/c1-22(2,3)34-21(32)27(4)14(10-13-7-8-13)19(30)28-12-23(11-15(28)17(24)29)20(31)26-18-16(33-23)6-5-9-25-18/h5-6,9,13-15H,7-8,10-12H2,1-4H3,(H2,24,29)(H,25,26,31)/t14-,15-,23+/m0/s1 |
| InChIKey | QXDYZQAWFYYVLO-XAPDGSRCSA-N |
| XLogP | 1.27 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |