C20H23F2N9O — CID 171733711
4-[[4-amino-5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 171733711) has the molecular formula C20H23F2N9O and a molecular weight of 443.46 g/mol. Its IUPAC name is 4-[[4-amino-5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[4-amino-5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 171733711 |
| Molecular Formula | C20H23F2N9O |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 4-[[4-amino-5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(Nc2nc(N)c3c(-c4ccc5nnn(CC(F)F)c5n4)ccn3n2)CC1 |
| InChI | InChI=1S/C20H23F2N9O/c1-20(32)7-4-11(5-8-20)24-19-26-17(23)16-12(6-9-30(16)28-19)13-2-3-14-18(25-13)31(29-27-14)10-15(21)22/h2-3,6,9,11,15,32H,4-5,7-8,10H2,1H3,(H3,23,24,26,28) |
| InChIKey | RJNPNTXYNAUZMV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 132.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |