C21H24F3N9O — CID 171733949
1-methyl-4-[[4-(methylamino)-5-[3-(2,2,2-trifluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol (PubChem CID 171733949) has the molecular formula C21H24F3N9O and a molecular weight of 475.48 g/mol. Its IUPAC name is 1-methyl-4-[[4-(methylamino)-5-[3-(2,2,2-trifluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 1-methyl-4-[[4-(methylamino)-5-[3-(2,2,2-trifluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 171733949 |
| Molecular Formula | C21H24F3N9O |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 1-methyl-4-[[4-(methylamino)-5-[3-(2,2,2-trifluoroethyl)triazolo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexan-1-ol |
| SMILES | CNc1nc(NC2CCC(C)(O)CC2)nn2ccc(-c3ccc4nnn(CC(F)(F)F)c4n3)c12 |
| InChI | InChI=1S/C21H24F3N9O/c1-20(34)8-5-12(6-9-20)26-19-28-17(25-2)16-13(7-10-32(16)30-19)14-3-4-15-18(27-14)33(31-29-15)11-21(22,23)24/h3-4,7,10,12,34H,5-6,8-9,11H2,1-2H3,(H2,25,26,28,30) |
| InChIKey | IGPKTTNEMHKLNU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |