C14H10F3N3O2 — CID 171734881
5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine (PubChem CID 171734881) has the molecular formula C14H10F3N3O2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine.
| Compound Name | 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine |
|---|---|
| PubChem CID | 171734881 |
| Molecular Formula | C14H10F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine |
| SMILES | [2H]C1([2H])c2ccc(C(F)(F)F)nc2-c2cccc([N+](=O)[O-])c2N1C |
| InChI | InChI=1S/C14H10F3N3O2/c1-19-7-8-5-6-11(14(15,16)17)18-12(8)9-3-2-4-10(13(9)19)20(21)22/h2-6H,7H2,1H3/i7D2 |
| InChIKey | RJDUHWMFJVSXIY-RJSZUWSASA-N |
| XLogP | 3.63 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|