About 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine
5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine (PubChem CID 171734881) has the molecular formula C14H10F3N3O2
and a molecular weight of 311.26 g/mol. Its IUPAC name is 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine.
Molecular Properties
| Compound Name | 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine |
| PubChem CID | 171734881 |
| Molecular Formula | C14H10F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine |
| SMILES | [2H]C1([2H])c2ccc(C(F)(F)F)nc2-c2cccc([N+](=O)[O-])c2N1C |
| InChI | InChI=1S/C14H10F3N3O2/c1-19-7-8-5-6-11(14(15,16)17)18-12(8)9-3-2-4-10(13(9)19)20(21)22/h2-6H,7H2,1H3/i7D2 |
| InChIKey | RJDUHWMFJVSXIY-RJSZUWSASA-N |
| XLogP | 3.63 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine?
The IUPAC name of 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine (CID 171734881) is 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine.
What is the SMILES notation for 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine?
The canonical SMILES for 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine is [2H]C1([2H])c2ccc(C(F)(F)F)nc2-c2cccc([N+](=O)[O-])c2N1C.
What is the InChIKey of 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine?
The InChIKey is RJDUHWMFJVSXIY-RJSZUWSASA-N. The full InChI is InChI=1S/C14H10F3N3O2/c1-19-7-8-5-6-11(14(15,16)17)18-12(8)9-3-2-4-10(13(9)19)20(21)22/h2-6H,7H2,1H3/i7D2.
What are the key properties of 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine?
5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine has a molecular weight of 311.26 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dideuterio-6-methyl-7-nitro-2-(trifluoromethyl)benzo[h][1,6]naphthyridine is sourced from PubChem (CID 171734881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).