C16H27BN2O3 — CID 171734939
1-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-2-methylpropan-2-ol (PubChem CID 171734939) has the molecular formula C16H27BN2O3 and a molecular weight of 306.22 g/mol. Its IUPAC name is 1-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-2-methylpropan-2-ol.
| Compound Name | 1-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 171734939 |
| Molecular Formula | C16H27BN2O3 |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CNc1ccc(B2OC(C)(C)C(C)(C)O2)cc1N |
| InChI | InChI=1S/C16H27BN2O3/c1-14(2,20)10-19-13-8-7-11(9-12(13)18)17-21-15(3,4)16(5,6)22-17/h7-9,19-20H,10,18H2,1-6H3 |
| InChIKey | WMVCVOCPUQGFFG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|