C28H40FN3O5 — CID 171735386
tert-butyl N-[2-[2-[2-[2-(2-but-3-ynyl-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 171735386) has the molecular formula C28H40FN3O5 and a molecular weight of 517.64 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-(2-but-3-ynyl-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-(2-but-3-ynyl-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 171735386 |
| Molecular Formula | C28H40FN3O5 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-(2-but-3-ynyl-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | C#CCCN1CCc2c(c3cc(F)ccc3n2CCOCCOCCOCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C28H40FN3O5/c1-5-6-11-31-12-9-26-24(21-31)23-20-22(29)7-8-25(23)32(26)13-15-35-17-19-36-18-16-34-14-10-30-27(33)37-28(2,3)4/h1,7-8,20H,6,9-19,21H2,2-4H3,(H,30,33) |
| InChIKey | GDAFCCUAGZRLAL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|