C11H14N2O2 — CID 171735423
ethyl (1S)-2-(4-methylpyrimidin-2-yl)cyclopropane-1-carboxylate (PubChem CID 171735423) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is ethyl (1S)-2-(4-methylpyrimidin-2-yl)cyclopropane-1-carboxylate.
| Compound Name | ethyl (1S)-2-(4-methylpyrimidin-2-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 171735423 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | ethyl (1S)-2-(4-methylpyrimidin-2-yl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC1c1nccc(C)n1 |
| InChI | InChI=1S/C11H14N2O2/c1-3-15-11(14)9-6-8(9)10-12-5-4-7(2)13-10/h4-5,8-9H,3,6H2,1-2H3/t8?,9-/m0/s1 |
| InChIKey | CRVRQBTXJVWPCC-GKAPJAKFSA-N |
| XLogP | 1.45 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |