About 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one
6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one (PubChem CID 171735617) has the molecular formula C20H16N4O2S
and a molecular weight of 376.44 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one |
| PubChem CID | 171735617 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one |
| SMILES | Cn1ccc(COc2cc3c(cc2-c2ccc4ncsc4c2)C(=O)NC3)n1 |
| InChI | InChI=1S/C20H16N4O2S/c1-24-5-4-14(23-24)10-26-18-6-13-9-21-20(25)16(13)8-15(18)12-2-3-17-19(7-12)27-11-22-17/h2-8,11H,9-10H2,1H3,(H,21,25) |
| InChIKey | XZZQHLCJJBHVAR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one (CID 171735617) is 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one is Cn1ccc(COc2cc3c(cc2-c2ccc4ncsc4c2)C(=O)NC3)n1.
What is the InChIKey of 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one?
The InChIKey is XZZQHLCJJBHVAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O2S/c1-24-5-4-14(23-24)10-26-18-6-13-9-21-20(25)16(13)8-15(18)12-2-3-17-19(7-12)27-11-22-17/h2-8,11H,9-10H2,1H3,(H,21,25).
What are the key properties of 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one?
6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one has a molecular weight of 376.44 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzothiazol-6-yl)-5-[(1-methylpyrazol-3-yl)methoxy]-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 171735617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).