C23H19BrN6O — CID 171735851
15-bromo-5,25-dimethyl-4,5,12,19,21,26-hexazapentacyclo[21.3.1.02,6.012,20.013,18]heptacosa-1(26),2(6),3,13(18),14,16,19,23(27),24-nonaen-7-yn-22-one (PubChem CID 171735851) has the molecular formula C23H19BrN6O and a molecular weight of 475.35 g/mol. Its IUPAC name is 15-bromo-5,25-dimethyl-4,5,12,19,21,26-hexazapentacyclo[21.3.1.02,6.012,20.013,18]heptacosa-1(26),2(6),3,13(18),14,16,19,23(27),24-nonaen-7-yn-22-one.
| Compound Name | 15-bromo-5,25-dimethyl-4,5,12,19,21,26-hexazapentacyclo[21.3.1.02,6.012,20.013,18]heptacosa-1(26),2(6),3,13(18),14,16,19,23(27),24-nonaen-7-yn-22-one |
|---|---|
| PubChem CID | 171735851 |
| Molecular Formula | C23H19BrN6O |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 15-bromo-5,25-dimethyl-4,5,12,19,21,26-hexazapentacyclo[21.3.1.02,6.012,20.013,18]heptacosa-1(26),2(6),3,13(18),14,16,19,23(27),24-nonaen-7-yn-22-one |
| SMILES | Cc1cc2cc(n1)-c1cnn(C)c1C#CCCCn1c(nc3ccc(Br)cc31)NC2=O |
| InChI | InChI=1S/C23H19BrN6O/c1-14-10-15-11-19(26-14)17-13-25-29(2)20(17)6-4-3-5-9-30-21-12-16(24)7-8-18(21)27-23(30)28-22(15)31/h7-8,10-13H,3,5,9H2,1-2H3,(H,27,28,31) |
| InChIKey | KJSVOWARMJEZOX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|