C15H5F4I2O5- — CID 171737200
2,3,4,5-tetrafluoro-6-[(2-hydroxy-3,5-diiodophenyl)methoxycarbonyl]benzoate (PubChem CID 171737200) has the molecular formula C15H5F4I2O5- and a molecular weight of 595.00 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-[(2-hydroxy-3,5-diiodophenyl)methoxycarbonyl]benzoate.
| Compound Name | 2,3,4,5-tetrafluoro-6-[(2-hydroxy-3,5-diiodophenyl)methoxycarbonyl]benzoate |
|---|---|
| PubChem CID | 171737200 |
| Molecular Formula | C15H5F4I2O5- |
| Molecular Weight | 595.00 g/mol |
| Exact Mass | 594.82 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-[(2-hydroxy-3,5-diiodophenyl)methoxycarbonyl]benzoate |
| SMILES | O=C([O-])c1c(F)c(F)c(F)c(F)c1C(=O)OCc1cc(I)cc(I)c1O |
| InChI | InChI=1S/C15H6F4I2O5/c16-9-7(14(23)24)8(10(17)12(19)11(9)18)15(25)26-3-4-1-5(20)2-6(21)13(4)22/h1-2,22H,3H2,(H,23,24)/p-1 |
| InChIKey | KOQHXXOWPIPJSH-UHFFFAOYSA-M |
| XLogP | 2.88 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.00 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|