About N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide
N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 17173847) has the molecular formula C11H8Cl2N2O2
and a molecular weight of 271.10 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 17173847 |
| Molecular Formula | C11H8Cl2N2O2 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C11H8Cl2N2O2/c1-6-4-10(15-17-6)11(16)14-9-3-2-7(12)5-8(9)13/h2-5H,1H3,(H,14,16) |
| InChIKey | ULPKSWAQDCJLMN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide (CID 17173847) is N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide is Cc1cc(C(=O)Nc2ccc(Cl)cc2Cl)no1.
What is the InChIKey of N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide?
The InChIKey is ULPKSWAQDCJLMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2N2O2/c1-6-4-10(15-17-6)11(16)14-9-3-2-7(12)5-8(9)13/h2-5H,1H3,(H,14,16).
What are the key properties of N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide?
N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide has a molecular weight of 271.10 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 17173847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).