C31H31NS — CID 171741518
2-(4-tert-butylnaphthalen-2-yl)-4-[5-(2-methylpropyl)-1-benzothiophen-2-yl]pyridine (PubChem CID 171741518) has the molecular formula C31H31NS and a molecular weight of 449.66 g/mol. Its IUPAC name is 2-(4-tert-butylnaphthalen-2-yl)-4-[5-(2-methylpropyl)-1-benzothiophen-2-yl]pyridine.
| Compound Name | 2-(4-tert-butylnaphthalen-2-yl)-4-[5-(2-methylpropyl)-1-benzothiophen-2-yl]pyridine |
|---|---|
| PubChem CID | 171741518 |
| Molecular Formula | C31H31NS |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-(4-tert-butylnaphthalen-2-yl)-4-[5-(2-methylpropyl)-1-benzothiophen-2-yl]pyridine |
| SMILES | CC(C)Cc1ccc2sc(-c3ccnc(-c4cc(C(C)(C)C)c5ccccc5c4)c3)cc2c1 |
| InChI | InChI=1S/C31H31NS/c1-20(2)14-21-10-11-29-25(15-21)19-30(33-29)23-12-13-32-28(18-23)24-16-22-8-6-7-9-26(22)27(17-24)31(3,4)5/h6-13,15-20H,14H2,1-5H3 |
| InChIKey | VRZJFFBFMCTKMR-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |