C44H56IrN3O3- — CID 171742020
4-[6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)pyrimidin-4-yl]-3-(2-methylpropyl)furo[2,3-b]pyridine;(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium (PubChem CID 171742020) has the molecular formula C44H56IrN3O3- and a molecular weight of 867.17 g/mol. Its IUPAC name is 4-[6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)pyrimidin-4-yl]-3-(2-methylpropyl)furo[2,3-b]pyridine;(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium.
| Compound Name | 4-[6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)pyrimidin-4-yl]-3-(2-methylpropyl)furo[2,3-b]pyridine;(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 171742020 |
| Molecular Formula | C44H56IrN3O3- |
| Molecular Weight | 867.17 g/mol |
| Exact Mass | 867.40 |
| IUPAC Name | 4-[6-(4-tert-butyl-1H-naphthalen-1-id-2-yl)pyrimidin-4-yl]-3-(2-methylpropyl)furo[2,3-b]pyridine;(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium |
| SMILES | CC(C)Cc1coc2nccc(-c3cc(-c4[c-]c5ccccc5c(C(C)(C)C)c4)ncn3)c12.CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.[Ir] |
| InChI | InChI=1S/C29H28N3O.C15H28O2.Ir/c1-18(2)12-21-16-33-28-27(21)23(10-11-30-28)26-15-25(31-17-32-26)20-13-19-8-6-7-9-22(19)24(14-20)29(3,4)5;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h6-11,14-18H,12H2,1-5H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | BRHOGUZTRBUUER-SWPBDETKSA-N |
| XLogP | 12.05 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.17 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|