C43H53IrN2O2S- — CID 171742086
5-[2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]-3-(2-methylpropyl)thieno[2,3-b]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 171742086) has the molecular formula C43H53IrN2O2S- and a molecular weight of 854.19 g/mol. Its IUPAC name is 5-[2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]-3-(2-methylpropyl)thieno[2,3-b]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 5-[2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]-3-(2-methylpropyl)thieno[2,3-b]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 171742086 |
| Molecular Formula | C43H53IrN2O2S- |
| Molecular Weight | 854.19 g/mol |
| Exact Mass | 854.35 |
| IUPAC Name | 5-[2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-pyridinyl]-3-(2-methylpropyl)thieno[2,3-b]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)Cc1csc2ncc(-c3ccnc(-c4[c-]c5ccccc5c(C(C)(C)C)c4)c3)cc12.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C30H29N2S.C13H24O2.Ir/c1-19(2)12-24-18-33-29-26(24)14-23(17-32-29)20-10-11-31-28(16-20)22-13-21-8-6-7-9-25(21)27(15-22)30(3,4)5;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-11,14-19H,12H2,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | IRUFDYXABYYEKV-DZTQYQPZSA-N |
| XLogP | 12.34 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.19 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|