C16H26F8 — CID 171742432
3,3,5,5,7,7,9,9-octafluoro-2,2,11,11-tetramethyldodecane (PubChem CID 171742432) has the molecular formula C16H26F8 and a molecular weight of 370.37 g/mol. Its IUPAC name is 3,3,5,5,7,7,9,9-octafluoro-2,2,11,11-tetramethyldodecane.
| Compound Name | 3,3,5,5,7,7,9,9-octafluoro-2,2,11,11-tetramethyldodecane |
|---|---|
| PubChem CID | 171742432 |
| Molecular Formula | C16H26F8 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3,3,5,5,7,7,9,9-octafluoro-2,2,11,11-tetramethyldodecane |
| SMILES | CC(C)(C)CC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)C(C)(C)C |
| InChI | InChI=1S/C16H26F8/c1-11(2,3)7-13(17,18)8-14(19,20)9-15(21,22)10-16(23,24)12(4,5)6/h7-10H2,1-6H3 |
| InChIKey | HYTYSJXIDVVNSN-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |