C46H46F3N3O3 — CID 171743552
(6S,8R)-6-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-8-methyl-7-(2-methylpropyl)-3-trityl-8,9-dihydro-6H-[1,3]oxazolo[5,4-f]isoquinolin-2-one (PubChem CID 171743552) has the molecular formula C46H46F3N3O3 and a molecular weight of 745.89 g/mol. Its IUPAC name is (6S,8R)-6-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-8-methyl-7-(2-methylpropyl)-3-trityl-8,9-dihydro-6H-[1,3]oxazolo[5,4-f]isoquinolin-2-one.
| Compound Name | (6S,8R)-6-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-8-methyl-7-(2-methylpropyl)-3-trityl-8,9-dihydro-6H-[1,3]oxazolo[5,4-f]isoquinolin-2-one |
|---|---|
| PubChem CID | 171743552 |
| Molecular Formula | C46H46F3N3O3 |
| Molecular Weight | 745.89 g/mol |
| Exact Mass | 745.35 |
| IUPAC Name | (6S,8R)-6-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-8-methyl-7-(2-methylpropyl)-3-trityl-8,9-dihydro-6H-[1,3]oxazolo[5,4-f]isoquinolin-2-one |
| SMILES | CC(C)CN1[C@H](c2c(F)cc(OCCN3CC(CF)C3)cc2F)c2ccc3c(oc(=O)n3C(c3ccccc3)(c3ccccc3)c3ccccc3)c2C[C@H]1C |
| InChI | InChI=1S/C46H46F3N3O3/c1-30(2)27-51-31(3)23-38-37(43(51)42-39(48)24-36(25-40(42)49)54-22-21-50-28-32(26-47)29-50)19-20-41-44(38)55-45(53)52(41)46(33-13-7-4-8-14-33,34-15-9-5-10-16-34)35-17-11-6-12-18-35/h4-20,24-25,30-32,43H,21-23,26-29H2,1-3H3/t31-,43+/m1/s1 |
| InChIKey | LGJZEMKAHMEDGG-UTNXLURDSA-N |
| XLogP | 8.98 |
| TPSA | 50.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.89 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|