C16H15Cl3N2O — CID 17174463
1-[1-(4-chlorophenyl)propyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 17174463) has the molecular formula C16H15Cl3N2O and a molecular weight of 357.67 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)propyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)propyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 17174463 |
| Molecular Formula | C16H15Cl3N2O |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 1-[1-(4-chlorophenyl)propyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | CCC(NC(=O)Nc1cccc(Cl)c1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl3N2O/c1-2-13(10-6-8-11(17)9-7-10)20-16(22)21-14-5-3-4-12(18)15(14)19/h3-9,13H,2H2,1H3,(H2,20,21,22) |
| InChIKey | HEWCXGQDSPQWMY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |