C21H29N9O4S — CID 171744678
[(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-(4-butan-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 171744678) has the molecular formula C21H29N9O4S and a molecular weight of 503.59 g/mol. Its IUPAC name is [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-(4-butan-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-(4-butan-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 171744678 |
| Molecular Formula | C21H29N9O4S |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-(4-butan-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCC(C)S(=O)(=O)N1CCN(C(=O)[C@@H]2CCCN2c2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C21H29N9O4S/c1-3-14(2)35(32,33)28-11-9-27(10-12-28)18(31)15-6-4-8-29(15)20-24-19(22)30-21(25-20)23-17(26-30)16-7-5-13-34-16/h5,7,13-15H,3-4,6,8-12H2,1-2H3,(H2,22,23,24,25,26)/t14?,15-/m0/s1 |
| InChIKey | PZEMCGWPHFJSOC-LOACHALJSA-N |
| XLogP | 0.60 |
| TPSA | 156.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |