About 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one
3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one (PubChem CID 171744974) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one |
| PubChem CID | 171744974 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)c(C(C)(C)C)c(C(C)(C)C)c1C |
| InChI | InChI=1S/C15H25NO/c1-9-10(2)16-13(17)12(15(6,7)8)11(9)14(3,4)5/h1-8H3,(H,16,17) |
| InChIKey | DBOUNLBDOFYLIW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one?
The IUPAC name of 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one (CID 171744974) is 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one is Cc1[nH]c(=O)c(C(C)(C)C)c(C(C)(C)C)c1C.
What is the InChIKey of 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one?
The InChIKey is DBOUNLBDOFYLIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-9-10(2)16-13(17)12(15(6,7)8)11(9)14(3,4)5/h1-8H3,(H,16,17).
What are the key properties of 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one?
3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one has a molecular weight of 235.37 g/mol, XLogP of 3.59, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butyl-5,6-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 171744974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).