C18H14FNO3 — CID 171745595
1-[2-(4-fluorophenyl)ethyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 171745595) has the molecular formula C18H14FNO3 and a molecular weight of 311.31 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 171745595 |
| Molecular Formula | C18H14FNO3 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(CCc2ccc(F)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C18H14FNO3/c19-13-7-5-12(6-8-13)9-10-20-11-15(18(22)23)17(21)14-3-1-2-4-16(14)20/h1-8,11H,9-10H2,(H,22,23) |
| InChIKey | RLQZUNNRTPPFBY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |