About [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate
[5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate (PubChem CID 171745610) has the molecular formula C14H17ClFNO4
and a molecular weight of 317.74 g/mol. Its IUPAC name is [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate.
Molecular Properties
| Compound Name | [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate |
| PubChem CID | 171745610 |
| Molecular Formula | C14H17ClFNO4 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate |
| SMILES | CCOc1c(C(C)O)cc(Cl)c(F)c1OC(=O)N1CCC1 |
| InChI | InChI=1S/C14H17ClFNO4/c1-3-20-12-9(8(2)18)7-10(15)11(16)13(12)21-14(19)17-5-4-6-17/h7-8,18H,3-6H2,1-2H3 |
| InChIKey | UZUBQYDVXMIHGG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate?
The IUPAC name of [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate (CID 171745610) is [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate.
What is the SMILES notation for [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate?
The canonical SMILES for [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate is CCOc1c(C(C)O)cc(Cl)c(F)c1OC(=O)N1CCC1.
What is the InChIKey of [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate?
The InChIKey is UZUBQYDVXMIHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClFNO4/c1-3-20-12-9(8(2)18)7-10(15)11(16)13(12)21-14(19)17-5-4-6-17/h7-8,18H,3-6H2,1-2H3.
What are the key properties of [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate?
[5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate has a molecular weight of 317.74 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-2-ethoxy-6-fluoro-3-(1-hydroxyethyl)phenyl] azetidine-1-carboxylate is sourced from PubChem (CID 171745610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).