About [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid
[6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid (PubChem CID 171745968) has the molecular formula C19H16BN3O4
and a molecular weight of 361.17 g/mol. Its IUPAC name is [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid.
Molecular Properties
| Compound Name | [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid |
| PubChem CID | 171745968 |
| Molecular Formula | C19H16BN3O4 |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid |
| SMILES | CC(C)(C)c1nnc(-c2c(C#N)ccc3c2oc2c(B(O)O)cccc23)o1 |
| InChI | InChI=1S/C19H16BN3O4/c1-19(2,3)18-23-22-17(27-18)14-10(9-21)7-8-12-11-5-4-6-13(20(24)25)15(11)26-16(12)14/h4-8,24-25H,1-3H3 |
| InChIKey | OUYIDMVOFBMUTR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid?
The IUPAC name of [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid (CID 171745968) is [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid.
What is the SMILES notation for [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid?
The canonical SMILES for [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid is CC(C)(C)c1nnc(-c2c(C#N)ccc3c2oc2c(B(O)O)cccc23)o1.
What is the InChIKey of [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid?
The InChIKey is OUYIDMVOFBMUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16BN3O4/c1-19(2,3)18-23-22-17(27-18)14-10(9-21)7-8-12-11-5-4-6-13(20(24)25)15(11)26-16(12)14/h4-8,24-25H,1-3H3.
What are the key properties of [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid?
[6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid has a molecular weight of 361.17 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-cyanodibenzofuran-4-yl]boronic acid is sourced from PubChem (CID 171745968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).