C45H28N2O2 — CID 171747514
N-[4-(4,5,6,7,8,9,10,11-octadeuteriophenanthro[9,10-d][1,3]oxazol-2-yl)phenyl]-N-(2-phenylphenyl)dibenzofuran-2-amine (PubChem CID 171747514) has the molecular formula C45H28N2O2 and a molecular weight of 636.78 g/mol. Its IUPAC name is N-[4-(4,5,6,7,8,9,10,11-octadeuteriophenanthro[9,10-d][1,3]oxazol-2-yl)phenyl]-N-(2-phenylphenyl)dibenzofuran-2-amine.
| Compound Name | N-[4-(4,5,6,7,8,9,10,11-octadeuteriophenanthro[9,10-d][1,3]oxazol-2-yl)phenyl]-N-(2-phenylphenyl)dibenzofuran-2-amine |
|---|---|
| PubChem CID | 171747514 |
| Molecular Formula | C45H28N2O2 |
| Molecular Weight | 636.78 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | N-[4-(4,5,6,7,8,9,10,11-octadeuteriophenanthro[9,10-d][1,3]oxazol-2-yl)phenyl]-N-(2-phenylphenyl)dibenzofuran-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1nc(-c3ccc(N(c4ccc5oc6ccccc6c5c4)c4ccccc4-c4ccccc4)cc3)oc1c1c([2H])c([2H])c([2H])c([2H])c12 |
| InChI | InChI=1S/C45H28N2O2/c1-2-12-29(13-3-1)33-14-8-10-20-40(33)47(32-26-27-42-39(28-32)36-17-9-11-21-41(36)48-42)31-24-22-30(23-25-31)45-46-43-37-18-6-4-15-34(37)35-16-5-7-19-38(35)44(43)49-45/h1-28H/i4D,5D,6D,7D,15D,16D,18D,19D |
| InChIKey | FDNMBVYYQJKVPQ-FAOCCKCVSA-N |
| XLogP | 12.84 |
| TPSA | 42.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.78 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|