C39H24N2OS — CID 171747591
N-[4-(4,5,6,7,8,9,10,11-octadeuteriophenanthro[9,10-d][1,3]thiazol-2-yl)phenyl]-N-phenyldibenzofuran-3-amine (PubChem CID 171747591) has the molecular formula C39H24N2OS and a molecular weight of 576.75 g/mol. Its IUPAC name is N-[4-(4,5,6,7,8,9,10,11-octadeuteriophenanthro[9,10-d][1,3]thiazol-2-yl)phenyl]-N-phenyldibenzofuran-3-amine.
| Compound Name | N-[4-(4,5,6,7,8,9,10,11-octadeuteriophenanthro[9,10-d][1,3]thiazol-2-yl)phenyl]-N-phenyldibenzofuran-3-amine |
|---|---|
| PubChem CID | 171747591 |
| Molecular Formula | C39H24N2OS |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | N-[4-(4,5,6,7,8,9,10,11-octadeuteriophenanthro[9,10-d][1,3]thiazol-2-yl)phenyl]-N-phenyldibenzofuran-3-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1nc(-c3ccc(N(c4ccccc4)c4ccc5c(c4)oc4ccccc45)cc3)sc1c1c([2H])c([2H])c([2H])c([2H])c12 |
| InChI | InChI=1S/C39H24N2OS/c1-2-10-26(11-3-1)41(28-22-23-32-31-14-8-9-17-35(31)42-36(32)24-28)27-20-18-25(19-21-27)39-40-37-33-15-6-4-12-29(33)30-13-5-7-16-34(30)38(37)43-39/h1-24H/i4D,5D,6D,7D,12D,13D,15D,16D |
| InChIKey | UEESYPWAJMPSOG-NRDWQMOXSA-N |
| XLogP | 11.64 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|