C12H15Br — CID 171748613
1-(3-bromo-2,4,5,6-tetradeuteriophenyl)-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane (PubChem CID 171748613) has the molecular formula C12H15Br and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-(3-bromo-2,4,5,6-tetradeuteriophenyl)-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane.
| Compound Name | 1-(3-bromo-2,4,5,6-tetradeuteriophenyl)-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane |
|---|---|
| PubChem CID | 171748613 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-(3-bromo-2,4,5,6-tetradeuteriophenyl)-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane |
| SMILES | [2H]c1c([2H])c(Br)c([2H])c(C2([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C2([2H])[2H])c1[2H] |
| InChI | InChI=1S/C12H15Br/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h4,7-10H,1-3,5-6H2/i1D2,2D2,3D2,4D,5D2,6D2,7D,8D,9D,10D |
| InChIKey | KTNLLCDOFZYDDH-QPNOBYRBSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |