C34H38F2N6O — CID 171748793
4-[4-[(1R,6S)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-fluoronaphthalen-2-amine (PubChem CID 171748793) has the molecular formula C34H38F2N6O and a molecular weight of 584.72 g/mol. Its IUPAC name is 4-[4-[(1R,6S)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-fluoronaphthalen-2-amine.
| Compound Name | 4-[4-[(1R,6S)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-fluoronaphthalen-2-amine |
|---|---|
| PubChem CID | 171748793 |
| Molecular Formula | C34H38F2N6O |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 4-[4-[(1R,6S)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-fluoronaphthalen-2-amine |
| SMILES | C[C@H]1CN2CCC[C@@]2(COc2nc(N3CC[C@@H]4CC[C@H](C3)N4)c3ccc(-c4cc(N)cc5cccc(F)c45)c(F)c3n2)C1 |
| InChI | InChI=1S/C34H38F2N6O/c1-20-16-34(11-3-12-42(34)17-20)19-43-33-39-31-26(32(40-33)41-13-10-23-6-7-24(18-41)38-23)9-8-25(30(31)36)27-15-22(37)14-21-4-2-5-28(35)29(21)27/h2,4-5,8-9,14-15,20,23-24,38H,3,6-7,10-13,16-19,37H2,1H3/t20-,23+,24-,34+/m1/s1 |
| InChIKey | SGZYGOKPRQJUEB-KNTRIHRQSA-N |
| XLogP | 5.89 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|