C35H40F2N6O — CID 171748798
4-[4-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethylnaphthalen-2-amine (PubChem CID 171748798) has the molecular formula C35H40F2N6O and a molecular weight of 598.74 g/mol. Its IUPAC name is 4-[4-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethylnaphthalen-2-amine.
| Compound Name | 4-[4-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethylnaphthalen-2-amine |
|---|---|
| PubChem CID | 171748798 |
| Molecular Formula | C35H40F2N6O |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | 4-[4-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-5-ethylnaphthalen-2-amine |
| SMILES | CCc1cccc2cc(N)cc(-c3ccc4c(N5CC[C@H]6CC[C@@H](C5)N6)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C35H40F2N6O/c1-2-21-5-3-6-22-15-24(38)16-29(30(21)22)27-9-10-28-32(31(27)37)40-34(44-20-35-12-4-13-43(35)18-23(36)17-35)41-33(28)42-14-11-25-7-8-26(19-42)39-25/h3,5-6,9-10,15-16,23,25-26,39H,2,4,7-8,11-14,17-20,38H2,1H3/t23-,25-,26+,35+/m1/s1 |
| InChIKey | ZLXYTCRNUGZNDH-KJEYBSIBSA-N |
| XLogP | 6.02 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|