About (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one
(2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one (PubChem CID 171748897) has the molecular formula C23H36N2O
and a molecular weight of 356.55 g/mol. Its IUPAC name is (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one.
Molecular Properties
| Compound Name | (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one |
| PubChem CID | 171748897 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)N[C@@H](Cc1cc2ccccc2n1C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C23H36N2O/c1-21(2,3)20(26)18(24-22(4,5)6)15-17-14-16-12-10-11-13-19(16)25(17)23(7,8)9/h10-14,18,24H,15H2,1-9H3/t18-/m0/s1 |
| InChIKey | OSBSAIGSEFNTHE-SFHVURJKSA-N |
| XLogP | 5.31 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one?
The IUPAC name of (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one (CID 171748897) is (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one.
What is the SMILES notation for (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one?
The canonical SMILES for (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one is CC(C)(C)N[C@@H](Cc1cc2ccccc2n1C(C)(C)C)C(=O)C(C)(C)C.
What is the InChIKey of (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one?
The InChIKey is OSBSAIGSEFNTHE-SFHVURJKSA-N. The full InChI is InChI=1S/C23H36N2O/c1-21(2,3)20(26)18(24-22(4,5)6)15-17-14-16-12-10-11-13-19(16)25(17)23(7,8)9/h10-14,18,24H,15H2,1-9H3/t18-/m0/s1.
What are the key properties of (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one?
(2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one has a molecular weight of 356.55 g/mol, XLogP of 5.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(tert-butylamino)-1-(1-tert-butylindol-2-yl)-4,4-dimethylpentan-3-one is sourced from PubChem (CID 171748897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).