C46H87NO11 — CID 171749608
[2-[3-[3-[1,3-di(octanoyloxy)propan-2-yloxy]propyl-(2-hydroxyethyl)amino]propoxy]-3-octanoyloxypropyl] octanoate (PubChem CID 171749608) has the molecular formula C46H87NO11 and a molecular weight of 830.20 g/mol. Its IUPAC name is [2-[3-[3-[1,3-di(octanoyloxy)propan-2-yloxy]propyl-(2-hydroxyethyl)amino]propoxy]-3-octanoyloxypropyl] octanoate.
| Compound Name | [2-[3-[3-[1,3-di(octanoyloxy)propan-2-yloxy]propyl-(2-hydroxyethyl)amino]propoxy]-3-octanoyloxypropyl] octanoate |
|---|---|
| PubChem CID | 171749608 |
| Molecular Formula | C46H87NO11 |
| Molecular Weight | 830.20 g/mol |
| Exact Mass | 829.63 |
| IUPAC Name | [2-[3-[3-[1,3-di(octanoyloxy)propan-2-yloxy]propyl-(2-hydroxyethyl)amino]propoxy]-3-octanoyloxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OCCCN(CCO)CCCOC(COC(=O)CCCCCCC)COC(=O)CCCCCCC |
| InChI | InChI=1S/C46H87NO11/c1-5-9-13-17-21-27-43(49)55-37-41(38-56-44(50)28-22-18-14-10-6-2)53-35-25-31-47(33-34-48)32-26-36-54-42(39-57-45(51)29-23-19-15-11-7-3)40-58-46(52)30-24-20-16-12-8-4/h41-42,48H,5-40H2,1-4H3 |
| InChIKey | VOQVEMVXWGRKJO-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.20 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|