C45H28F4N2 — CID 171749991
N,N-bis[3-(3,5-difluorophenyl)phenyl]-6,8-diphenylquinolin-2-amine (PubChem CID 171749991) has the molecular formula C45H28F4N2 and a molecular weight of 672.73 g/mol. Its IUPAC name is N,N-bis[3-(3,5-difluorophenyl)phenyl]-6,8-diphenylquinolin-2-amine.
| Compound Name | N,N-bis[3-(3,5-difluorophenyl)phenyl]-6,8-diphenylquinolin-2-amine |
|---|---|
| PubChem CID | 171749991 |
| Molecular Formula | C45H28F4N2 |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.22 |
| IUPAC Name | N,N-bis[3-(3,5-difluorophenyl)phenyl]-6,8-diphenylquinolin-2-amine |
| SMILES | Fc1cc(F)cc(-c2cccc(N(c3cccc(-c4cc(F)cc(F)c4)c3)c3ccc4cc(-c5ccccc5)cc(-c5ccccc5)c4n3)c2)c1 |
| InChI | InChI=1S/C45H28F4N2/c46-37-20-35(21-38(47)27-37)31-13-7-15-41(24-31)51(42-16-8-14-32(25-42)36-22-39(48)28-40(49)23-36)44-18-17-33-19-34(29-9-3-1-4-10-29)26-43(45(33)50-44)30-11-5-2-6-12-30/h1-28H |
| InChIKey | RWJJDGLJQBQDOT-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |