C42H25F4NO — CID 171750067
3-dibenzofuran-2-yl-N,N-bis[3-(3,5-difluorophenyl)phenyl]aniline (PubChem CID 171750067) has the molecular formula C42H25F4NO and a molecular weight of 635.66 g/mol. Its IUPAC name is 3-dibenzofuran-2-yl-N,N-bis[3-(3,5-difluorophenyl)phenyl]aniline.
| Compound Name | 3-dibenzofuran-2-yl-N,N-bis[3-(3,5-difluorophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 171750067 |
| Molecular Formula | C42H25F4NO |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | 3-dibenzofuran-2-yl-N,N-bis[3-(3,5-difluorophenyl)phenyl]aniline |
| SMILES | Fc1cc(F)cc(-c2cccc(N(c3cccc(-c4cc(F)cc(F)c4)c3)c3cccc(-c4ccc5oc6ccccc6c5c4)c3)c2)c1 |
| InChI | InChI=1S/C42H25F4NO/c43-32-16-30(17-33(44)24-32)27-7-4-10-37(21-27)47(38-11-5-8-28(22-38)31-18-34(45)25-35(46)19-31)36-9-3-6-26(20-36)29-14-15-42-40(23-29)39-12-1-2-13-41(39)48-42/h1-25H |
| InChIKey | IWGXNBWORWYMEY-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |